S-(-)-2-ChloropropionicAcid CAS:29617-66-1
Catalog Number | XD95815 |
Product Name | S-(-)-2-ChloropropionicAcid |
CAS | 29617-66-1 |
Molecular Formula | C3H5ClO2 |
Molecular Weight | 108.52 |
Product Specification
Appearance | White powder |
Assay | 99% min |
S-(-)-2-Chloropropionic acid is a compound that has various effects and applications in different fields. Let's explore some of the significant effects of S-(-)-2-Chloropropionic acid.One of the primary effects of S-(-)-2-Chloropropionic acid is its role as a starting material in the synthesis of pharmaceutical intermediates. It serves as an important building block in the production of various drugs and active pharmaceutical ingredients. Its chemical structure allows for the introduction of functional groups and modifications necessary for the development of specific pharmaceutical compounds. This property makes S-(-)-2-Chloropropionic acid valuable in the pharmaceutical industry.Additionally, S-(-)-2-Chloropropionic acid has been studied for its potential herbicidal activity. It has been found to exhibit inhibitory effects on the growth of certain plant species. The ability of S-(-)-2-Chloropropionic acid to control plant growth makes it potentially useful in agriculture and horticulture, assisting in weed control and crop management.Furthermore, S-(-)-2-Chloropropionic acid has been explored for its role as a corrosion inhibitor. It has been found to have inhibitory effects on the corrosion of metals, particularly copper and steel, in various environments. This property makes S-(-)-2-Chloropropionic acid valuable in industries where corrosion control is essential, such as metal fabrication and construction.Moreover, S-(-)-2-Chloropropionic acid has been investigated for its potential impact on gut microbiota. Studies have shown that it can disrupt the microbial community in the gut, leading to changes in the composition and activity of the gut microbiome. This effect has implications for understanding the interactions between S-(-)-2-Chloropropionic acid and the human gut, which may have implications for the development of therapies targeting the gut microbiota.In summary, S-(-)-2-Chloropropionic acid demonstrates important effects as a pharmaceutical intermediate, herbicidal agent, corrosion inhibitor, and modulator of gut microbiota. Its diverse effects make it valuable in various fields, including pharmaceuticals, agriculture, materials science, and gut health research. Further studies and applications of S-(-)-2-Chloropropionic acid may lead to new discoveries and advances in these and other areas.