GLUTATHIONE CAS: 70-18-8
Catalog Number | XD96494 |
Product Name | GLUTATHIONE |
CAS | 70-18-8 |
Molecular Formula | C10H17N3O6S(C2H4O2)(C2H4O2) |
Molecular Weight | 307.32 |
Storage Details | Ambient |
Product Specification
Appearance | White powder |
Assay | 99% min |
Glutathione is a powerful antioxidant that plays a crucial role in maintaining optimal health and well-being. This tripeptide is involved in various essential processes in the body, including detoxification, immune function, and antioxidant defense. Glutathione works to neutralize free radicals, reduce oxidative stress, and protect cells from damage caused by environmental toxins and pollutants. Additionally, glutathione supports the immune system by aiding in the production of white blood cells, which are essential for fighting off infections and illnesses. In skincare, glutathione is known for its skin-brightening effects, as it helps to reduce the production of melanin and lighten dark spots or hyperpigmentation. By promoting overall health and supporting cellular function, glutathione is a valuable compound that contributes to vitality, immunity, and skin radiance.